| Catalog Number |
ACM87828862-1 |
| CAS |
87828-86-2 |
| Structure |
 |
| Synonyms |
L-2-Amino-4-methylpentanoic acid-d3 |
| IUPAC Name |
(2S)-2-amino-5,5,5-trideuterio-4-methylpentanoic acid |
| Molecular Weight |
134.19 |
| Molecular Formula |
C6H10D3NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N |
| InChI |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1D3/t4?,5- |
| InChI Key |
ROHFNLRQFUQHCH-LONBSJBQSA-N |
| Melting Point |
>300 °C (lit.) |
| Chemical Formula |
CH3CH(CD3)CH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
61-90-5 |
| Unlabeled Synonyms |
(S)-2-Amino-4-methylpentanoic acid; H-L-Leu-OH |
