| Catalog Number |
ACM1190594229-1 |
| CAS |
1190594-22-9 |
| Synonyms |
Fmoc-[D]Leu-OH |
| IUPAC Name |
(2S)-2,3,3,4,5,5,5-heptadeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethyl)pentanoic acid |
| Molecular Weight |
363.48 |
| Molecular Formula |
C21H13D10NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| InChI |
InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1/i1D3,2D3,11D2,13D,19D |
| InChI Key |
CBPJQFCAFFNICX-QDXFTFMQSA-N |
| Chemical Formula |
(CD3)2CDCD2CD(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
35661-60-0 |
| Unlabeled Synonyms |
FMOC-L-leucine; FMOC-L-Leu-OH |
