| Catalog Number |
ACM59935318-2 |
| CAS |
59935-31-8 |
| Structure |
 |
| Molecular Weight |
132.17 |
| Molecular Formula |
(CH3)2CHCH2CH(15NH2)COOH |
| Canonical SMILES |
CC(C)C[C@H]([15NH2])C(O)=O |
| InChI |
1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i7+1 |
| InChI Key |
ROHFNLRQFUQHCH-GEERXGHESA-N |
| Boiling Point |
225.8±23.0 °C at 760 mmHg |
| Melting Point |
>300 °C (lit.) |
| Flash Point |
90.3±22.6 °C |
| Purity |
99% (CP) |
| Density |
1.0±0.1 g/cm3 |
| Appearance |
powder |
| Storage |
Store refrigerated (-5 °C - 5 °C) and dessicated. |
| Exact Mass |
131.094635 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
0.73 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00075212 |
| Optical Activity |
[α]25/D +14.5°, c = 2 in 5 M HCl |
| PSA |
63.32 |
| Refractive Index |
1.463 |
| Type |
Labeled Amino Acids and Derivatives |
| Vapor Pressure |
0.0±0.9 mmHg at 25°C |
