| Catalog Number |
ACM127290602 |
| CAS |
127290-60-2 |
| Synonyms |
L-ISOLEUCINE-2-D1; α-Deutero-isoleucin; |
| IUPAC Name |
(2S,3S)-2-amino-2-deuterio-3-methylpentanoic acid |
| Molecular Weight |
132.18 |
| Molecular Formula |
C6H12DNO2 |
| Canonical SMILES |
[2H][C@]([C@@H](C)CC)(C(=O)O)N |
| InChI |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i5D |
| InChI Key |
AGPKZVBTJJNPAG-XIEIMECNSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3CH2CH(CH3)CD(NH2)COOH |
| Exact Mass |
132.10100 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
73-32-5 |
| Unlabeled Synonyms |
(2S,3S)-2-Amino-3-methylpentanoic; H-L-Ile-OH |
