| Catalog Number |
ACM59935307-2 |
| CAS |
59935-30-7 |
| Structure |
 |
| Molecular Weight |
132.17 |
| Molecular Formula |
CH3CH2CH(CH3)CH(15NH2)CO2H |
| Canonical SMILES |
CC[C@H](C)[C@H]([15NH2])C(O)=O |
| InChI |
1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i7+1 |
| InChI Key |
AGPKZVBTJJNPAG-NNXLWEQRSA-N |
| Melting Point |
168-170 °C (lit.) |
| Purity |
98% (CP) |
| Appearance |
solid |
| Application |
A labeled essential alpha-amino acid. A precursor to Succinyl CoA and Acetyl CoA. |
| Storage |
Store at room temperature away from light and moisture. |
| Exact Mass |
132.092 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
1.1447 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00144615 |
| Optical Activity |
[α]25/D +40.0°, c = 2 in 5 M HCl |
| PSA |
63.32 |
| Quality Level |
200 |
| Type |
Labeled Amino Acids and Derivatives |
| WGK Germany |
3 |
