| Catalog Number |
ACM182755415 |
| CAS |
182755-41-5 |
| Structure |
 |
| Synonyms |
L-Homocystine-D8 |
| IUPAC Name |
(2S)-4-[(3-amino-3-carboxy-1-deuteriopropyl)disulfanyl]-2,3,3,4,4-pentadeuterio-2-(dideuterioamino)butanoic acid |
| Molecular Weight |
276.39 |
| Molecular Formula |
C8H8D8N2O4S2 |
| Canonical SMILES |
[2H]C(CC(C(=O)O)N)SSC([2H])([2H])C([2H])([2H])[C@@]([2H])(C(=O)O)N([2H])[2H] |
| InChI |
InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6?/m0/s1/i1D2,3D2,4D,5D/hD2/t4?,5-,6? |
| InChI Key |
ZTVZLYBCZNMWCF-VMDTWGNNSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
[HOOCCH(NH2)CD2CD2S]2 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
626-72-2 |
| Synonyms (Unlabeled) |
L-4,4'-Dithiobis(2-aminobutyric acid); (H-L-Homocys-OH)2 |
