| Catalog Number |
ACM59681322-2 |
| CAS |
59681-32-2 |
| Structure |
 |
| Description |
L-Glutamine-15N-1 (L-Glutamic acid 5-amide-15N-1) is the 15N-labeled L-Glutamine. L-Glutamine (L-Glutamic acid 5-amide) is a non-essential amino acid present abundantly throughout the body and involved in many metabolic processes. L-Glutamine provides a source of carbons for oxidation in some cells. |
| Synonyms |
(S)-2,5-Diamino-5-oxopentanoic Acid-15N; 2-Aminoglutaramic Acid-15N; Acustasin-15N; Aesgen 14-15N; Cebrogen-15N; Glumin-15N; L-2-Aminoglutaramidic Acid-15N; L-Glutamic Acid γ-alphamide-15N; Levoglutamide-15N; NSC 27421-15N; Saforis-15N; Stimulina-15N; γ-Glutamine-15N; |
| Molecular Weight |
147.14 |
| Molecular Formula |
C5H10N15NO3 |
| Canonical SMILES |
N[C@@H](CCC([15NH2])=O)C(O)=O |
| InChI |
1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i7+1 |
| InChI Key |
ZDXPYRJPNDTMRX-QQKKVIQDSA-N |
| Boiling Point |
445.6±40.0 °C at 760 mmHg |
| Melting Point |
185ºC (dec.)(lit.) |
| Flash Point |
223.3±27.3 °C |
| Purity |
99% (CP) |
| Density |
1.3±0.1 g/cm3 |
| Appearance |
solid |
| Storage |
Store at room temperature away from light and moisture. |
| Exact Mass |
146.069138 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
-1.67 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00084214 |
| Optical Activity |
[α]25/D +33.0°, c = 2 in 5 M HCl |
| PSA |
106.41 |
| Quality Level |
200 |
| Refractive Index |
1.524 |
| Type |
All Aliphatics |
| Vapor Pressure |
0.0±2.3 mmHg at 25°C |
| WGK Germany |
3 |
