| Catalog Number |
ACM204451489-2 |
| CAS |
204451-48-9 |
| Structure |
 |
| Description |
L-Glutamine (15N2) is a non-essential amino acid that is an important component for cell culture media as well as for synthesizing isotopically labeled protein. It plays an important role in many metabolic pathways and may also be used as a standard. |
| Synonyms |
L-Glutamine-N2-15N; L-[2-15N]Glutamine; Glutamine; (2S)-2,5-Diamino-5-oxopentanoic acid; S(+)-Glutamine; H-GLN-OH; L(+)-Glutamine |
| Molecular Weight |
148.13 |
| Molecular Formula |
H215NCO(CH2)2CH(15NH2)COOH |
| Canonical SMILES |
[15NH2][C@@H](CCC([15NH2])=O)C(O)=O |
| InChI |
1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i6+1,7+1 |
| InChI Key |
ZDXPYRJPNDTMRX-QLUYOLLXSA-N |
| Melting Point |
185 °C (dec.) (lit.) |
| Appearance |
solid |
| Application |
Biomolecular NMR, Clinical MS, Metabolism, Metabolomics, Proteomics |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-292-1 (Unlabeled) |
| Exact Mass |
148.063 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
0.0644 |
| Mass Shift |
M+2 |
| MDL Number |
MFCD00084216 |
| Optical Activity |
[α]25/D +33.0°, c = 2 in 5 M HCl |
| PSA |
106.41 |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
56-85-9 |
| WGK Germany |
3 |
