Catalog Number |
ACM80143573-2 |
CAS |
80143-57-3 |
Structure |
|
Synonyms |
L-Glutamine-N2-15N; L-[2-15N]Glutamine; Glutamine; (2S)-2,5-Diamino-5-oxopentanoic acid; S(+)-Glutamine; H-GLN-OH; L(+)-Glutamine |
Molecular Weight |
147.14 |
Molecular Formula |
H2NCO(CH2)2CH(15NH2)COOH |
Canonical SMILES |
NC(=O)CC[C@H]([15NH2])C(O)=O |
InChI |
1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i6+1 |
InChI Key |
ZDXPYRJPNDTMRX-OGWWSMAPSA-N |
Melting Point |
185 °C (dec.) (lit.) |
Purity |
99% (CP) |
Appearance |
solid |
Application |
Biomolecular NMR, Clinical MS, Metabolism, Metabolomics, Proteomics |
Storage |
Store at room temperature away from light and moisture. |
EC Number |
200-292-1 (Unlabeled) |
Isotopic Enrichment |
98 atom % 15N |
Mass Shift |
M+1 |
MDL Number |
MFCD00084215 |
Optical Activity |
[α]25/D +33.0°, c = 2 in 5 M HCl |
Type |
Labeled Amino Acids and Derivatives |
Unlabeled CAS |
56-85-9 |