L-Carnitine:HCl, o-propionyl (N-Methyl-D3)
| Catalog Number |
ACM1334532192 |
| CAS |
1334532-19-2 |
| Structure |
 |
| Synonyms |
(R)-Propionyl carnitine-D3 chloride |
| IUPAC Name |
[(2R)-3-carboxy-2-propanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride |
| Molecular Weight |
256.74 |
| Molecular Formula |
C10H17D3ClNO4 |
| InChI |
InChI=1S/C10H19NO4.ClH/c1-5-10(14)15-8(6-9(12)13)7-11(2,3)4;/h8H,5-7H2,1-4H3;1H/t8-;/m1./s1/i2D3; |
| InChI Key |
KTFMPDDJYRFWQE-WVKKGGDISA-N |
| Purity |
98% |
| Appearance |
White solid |
| Chemical Formula |
CD3N+(CH3)2CH2CH(OCOCH2CH3)CH2COO-·HCl |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CC.[Cl-] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Five years after receipt. Re-QC after 5 years. |
| Unlabeled CAS |
119793-66-7 |
Please kindly note that our products and services are for research use only.
