L-Carnitine:HCl, o-octanoyl (N-Methyl-D3)
| Catalog Number |
ACM1334532249 |
| CAS |
1334532-24-9 |
| Structure |
 |
| Synonyms |
(3R)-4-[Dimethyl(trideuteriomethyl)azaniumyl]-3-octanoyloxybutanoate:hydrochloride; Octanoyl L-carnitine-D3 chloride |
| IUPAC Name |
[(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride |
| Molecular Weight |
326.87 |
| Molecular Formula |
C15H27D3ClNO4 |
| InChI |
InChI=1S/C15H29NO4.ClH/c1-5-6-7-8-9-10-15(19)20-13(11-14(17)18)12-16(2,3)4;/h13H,5-12H2,1-4H3;1H/t13-;/m1./s1/i2D3; |
| InChI Key |
MYMFUYYXIJGKKU-HZUATLIXSA-N |
| Purity |
98% |
| Appearance |
White solid |
| Chemical Formula |
CD3N+(CH3)2CH2CH(OCO(CH2)6CH3)CH2COO-.HCl |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC.[Cl-] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Five years after receipt. Re-QC after five years. |
| Unlabeled CAS |
54377-02-5 |
Please kindly note that our products and services are for research use only.
