L-Carnitine:HCl, o-butyryl (N-Methyl-D3)
| Catalog Number |
ACM1334532216 |
| CAS |
1334532-21-6 |
| Structure |
 |
| Synonyms |
Butyryl-L-carnitine-d3 |
| IUPAC Name |
[(2R)-2-butanoyloxy-3-carboxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride |
| Molecular Weight |
270.77 |
| Molecular Formula |
C11H19D3ClNO4 |
| InChI |
InChI=1S/C11H21NO4.ClH/c1-5-6-11(15)16-9(7-10(13)14)8-12(2,3)4;/h9H,5-8H2,1-4H3;1H/t9-;/m1./s1/i2D3; |
| InChI Key |
SRYJSBLNSDMCEA-VGBYKQEUSA-N |
| Melting Point |
163-165 °C |
| Purity |
98% |
| Appearance |
White solid |
| Chemical Formula |
CD3N+(CH3)2CH2CH(OCO(CH2)2CH3)CH2COO-.HCl |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCC.[Cl-] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Five years after receipt. Re-QC after 5 years. |
| Unlabeled CAS |
162067-50-7 |
Please kindly note that our products and services are for research use only.
