L-Carnitine:HCl, o-acetyl (N-Methyl-D3)
| Catalog Number |
ACM1334532170 |
| CAS |
1334532-17-0 |
| Structure |
 |
| Synonyms |
Acetyl L-carnitine-d3 hydrochloride |
| IUPAC Name |
(3R)-3-acetyloxy-4-[dimethyl(trideuteriomethyl)azaniumyl]butanoate;hydrochloride |
| Molecular Weight |
242.72 |
| Molecular Formula |
C9H15D3ClNO4 |
| InChI |
InChI=1S/C9H17NO4.ClH/c1-7(11)14-8(5-9(12)13)6-10(2,3)4;/h8H,5-6H2,1-4H3;1H/t8-;/m1./s1/i2D3; |
| InChI Key |
JATPLOXBFFRHDN-WVKKGGDISA-N |
| Melting Point |
194 °C (381 °F) |
| Purity |
98% |
| Appearance |
White powder |
| Chemical Formula |
CD3N+(CH3)2CH2CH(OCOCH3)CH2COO-·HCl |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)C.Cl |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Five years after receipt. Re-QC after five years. |
| Unlabeled CAS |
5080-50-2 |
| Unlabeled Synonyms |
R(-)-2-Acetyloxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride |
Please kindly note that our products and services are for research use only.
