L-Carnitine:HCl (methyl-d3, 98%)
| Catalog Number |
ACM350818621-1 |
| CAS |
350818-62-1 |
| Structure |
 |
| Synonyms |
[(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium; [2H3]- L-Carnitine chloride |
| IUPAC Name |
[(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium;chloride |
| Molecular Weight |
200.68 |
| Molecular Formula |
C7H13D3NO3Cl |
| InChI |
InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/t6-;/m1./s1/i1D3; |
| InChI Key |
JXXCENBLGFBQJM-QKBJTWEASA-N |
| Melting Point |
142 °C (288 °F) |
| Purity |
98% |
| Appearance |
White solid |
| Isomeric SMILES |
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Two years after receipt. Re-QC after 2 years. |
| Unlabeled CAS |
6645-46-1 |
| Unlabeled Synonyms |
Karnitin; Levocarnitine; Vitamin BT; (-)-Beta-Hydroxy-y-(trimethylammonio)butyrate |
Please kindly note that our products and services are for research use only.
