| Catalog Number |
ACM204523159-2 |
| CAS |
204523-15-9 |
| Structure |
 |
| Synonyms |
N-(tert-Butoxycarbonyl)-L-aspartic acid-15N, L-Aspartic-15N acid, N-t-Boc derivative, Boc-Asp-OH-15N |
| Molecular Weight |
234.21 |
| Molecular Formula |
HO2CCH2CH(15NH-Boc)CO2H |
| Canonical SMILES |
CC(C)(C)OC(=O)[15NH][C@@H](CC(O)=O)C(O)=O |
| InChI |
1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14)/t5-/m0/s1/i10+1 |
| InChI Key |
KAJBMCZQVSQJDE-PYWYPUIGSA-N |
| Melting Point |
116-118 °C (lit.) |
| Density |
1.3±0.1 g/cm3 |
| Appearance |
Solid |
| Storage |
Keep container tightly closed in a dry and well-ventilated place |
| Exact Mass |
234.086975 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
0.6434 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00209688 |
| Optical Activity |
[α]20/D -7.3°, c = 2 in DMF |
| PSA |
116.42 |
| Quality Level |
200 |
| Refractive Index |
1.494 |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
7536-58-5 |
