| Catalog Number |
ACM3842259 |
| CAS |
3842-25-9 |
| Structure |
 |
| Synonyms |
L-Aspartic acid-2,3,3-d3, L-Aspartic Acid-d3, L-Asparagic Acid-d3, L-Asparaginic Acid-d3, L-Aminosuccinic Acid-d3, L-(+)-Aspartic Acid-d3, (S)-Aminobutanedioic Acid-d3, 489980_ALDRICH, S)-2-Aminobutanedioic Acid-d3, NSC 3973-d3, NSC 79553-d3, FT-0662308, 3842-25-9 |
| IUPAC Name |
(2S)-2-amino-2,3,3-trideuteriobutanedioic acid |
| Molecular Weight |
136.12 |
| Molecular Formula |
C4H4D3NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)N |
| InChI |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1D2,2D |
| InChI Key |
CKLJMWTZIZZHCS-RBXBQAPRSA-N |
| Melting Point |
>300 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Appearance |
White solid |
| Chemical Formula |
HOOCCD2CD(NH2)COOH |
| Exact Mass |
136.05600 |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
56-84-8 |
| Synonyms (Unlabeled) |
L-Asparaginic acid; (S)-2-Aminosuccinic acid; H-L-Asp-OH |
| WGK Germany |
3 |
