L-Arginine:HCl (Guanido-13C)
| Catalog Number |
ACM94740439 |
| CAS |
94740-43-9 |
| Molecular Weight |
211.65 |
| Molecular Formula |
13CC5H15ClN4O2 |
| Boiling Point |
235 °C (455 °F) at ca. 1013 hPa (760 mmHg)-Decomposes on heating |
| Melting Point |
226-230 °C (439-446 °F) |
| Purity |
98% |
| Density |
1.42 g/cm3 at 20 °C (68 °F) |
| Appearance |
Colorless/white crystalline |
| Chemical Formula |
H2N*C(=NH)NH(CH2)3CH(NH2)COOH·HCl |
| Isotopic Enrichment |
99 atom % 13C |
| Odor |
Odourless |
| pH |
5.5-7 at 211 g/L at 25 °C (77 °F) |
| Unlabeled CAS |
1119-34-2 |
| Unlabeled Synonyms |
(S)-(+)-Arginine; S-(+)-2-Amino-5[(aminoiminomethyl)amino]pentanoic acid |
Please kindly note that our products and services are for research use only.
