| Catalog Number |
ACM225101699-1 |
| CAS |
225101-69-9 |
| Structure |
 |
| Synonyms |
N-(9-Fluorenylmethoxycarbonyl)-L-alanine-2,3,3,3-d4 |
| IUPAC Name |
(2S)-2,3,3,3-tetradeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| Molecular Weight |
315.36 |
| Molecular Formula |
C18H13D4NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])[2H])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| InChI |
InChI=1S/C18H17NO4/c1-11(17(20)21)19-18(22)23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16H,10H2,1H3,(H,19,22)(H,20,21)/t11-/m0/s1/i1D3,11D |
| InChI Key |
QWXZOFZKSQXPDC-UAMNTACQSA-N |
| Melting Point |
147-153 °C (lit.) |
| Chemical Formula |
CD3CD(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
35661-39-3 |
| Synonyms (Unlabeled) |
FMOC-L-Alanine; FMOC-L-Ala-OH |
