| Catalog Number |
ACM139952877-1 |
| CAS |
139952-87-7 |
| Structure |
 |
| Synonyms |
Boc-Ala-OH-15N |
| IUPAC Name |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]propanoic acid |
| Molecular Weight |
190.22 |
| Molecular Formula |
C8H1515NO4 |
| Canonical SMILES |
C[C@@H](C(=O)O)[15NH]C(=O)OC(C)(C)C |
| InChI |
InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i9+1 |
| InChI Key |
QVHJQCGUWFKTSE-LBBOFACRSA-N |
| Melting Point |
79-83 °C (lit.) |
| Chemical Formula |
CH3CH(*NH-t-BOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % 15N |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
15761-38-3 |
| Unlabeled Synonyms |
BOC-L-Alanine; BOC-L-Ala-OH |
