Catalog Number |
ACM130551494 |
CAS |
130551-49-4 |
Structure |
 |
Synonyms |
[2H7]-L-Tyrosine; L-Tyrosine-α,β,β,2,3,5,6-d7 |
IUPAC Name |
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid |
Molecular Weight |
188.23 |
Molecular Formula |
C9H4D7NO3 |
Canonical SMILES |
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H])O)[2H] |
InChI |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D,3D,4D,5D2,8D |
InChI Key |
OUYCCCASQSFEME-BKKGXISKSA-N |
Purity |
98 atom % D |
Chemical Formula |
HOC6D4CD2CD(NH2)COOH |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H])O)[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
60-18-4 |
Synonyms (Unlabeled) |
L-Tyrosine; p-Hydroxyphenyl-L-alanine; H-L-Tyr-OH |