(±)-Ketoprofen-d4 (propionic-d4 acid)
| Catalog Number |
ACM1219805294-2 |
| CAS |
1219805-29-4 |
| Structure |
 |
| Synonyms |
(±)-Ketoprofen D4 (propionic D4 acid), 2-(3-Benzoylphenyl)-2,3,3,3-tetradeuterio-propanoic acid |
| IUPAC Name |
2-(3-benzoylphenyl)-2,3,3,3-tetradeuteriopropanoic acid |
| Molecular Weight |
258.31 |
| Molecular Formula |
C16D4H10O3 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])(C(=O)O)c1cccc(c1)C(=O)c2ccccc2 |
| InChI |
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3,11D |
| Storage |
-20 °C |
| Accurate Mass |
258.1194 |
| Alternative CAS |
22071-15-4 |
| API Family |
Ketoprofen |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
