(±)-Ketoprofen D3 (propionic D3 acid) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM159490558-3 |
| CAS |
159490-55-8 |
| Structure |
 |
| Synonyms |
(±)-Ketoprofen D3 (methyl D3), rac Ketoprofen-d3 |
| IUPAC Name |
2-(3-benzoylphenyl)-3,3,3-trideuteriopropanoic acid |
| Molecular Weight |
257.3 |
| Molecular Formula |
C16D3H11O3 |
| Canonical SMILES |
[2H]C([2H])([2H])C(C(=O)O)c1cccc(c1)C(=O)c2ccccc2 |
| InChI |
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3 |
| Storage |
+20 °C |
| Accurate Mass |
257.1131 |
| Alternative CAS |
22071-15-4 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
