| Catalog Number |
ACM17157129-1 |
| CAS |
17157-12-9 |
| Structure |
 |
| Synonyms |
Isoquinoline-1,3,4,5,6,7,8-d7 (ACI), Isoquinoline-d7 (8CI, 9CI) |
| IUPAC Name |
1,3,4,5,6,7,8-heptadeuterioisoquinoline |
| Molecular Weight |
136.2 |
| Molecular Formula |
C9D7N |
| Canonical SMILES |
[2H]c1nc([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] |
| InChI |
InChI=1S/C9H7N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-7H/i1D,2D,3D,4D,5D,6D,7D |
| Purity |
97 atom % D |
| Accurate Mass |
136.1018 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts,Heterocycles |
| Isotopic Enrichment |
97 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
119-65-3 |
