| Catalog Number |
ACM14397592-1 |
| CAS |
14397-59-2 |
| Structure |
 |
| Synonyms |
3,5,5-Trimethyl-2-cyclohexene-1-one |
| IUPAC Name |
2,4,4,6,6-pentadeuterio-5,5-dimethyl-3-(trideuteriomethyl)cyclohex-2-en-1-one |
| Molecular Weight |
146.26 |
| Molecular Formula |
C9H6D8O |
| InChI |
InChI=1S/C9H14O/c1-7-4-8(10)6-9(2,3)5-7/h4H,5-6H2,1-3H3/i1D3,4D,5D2,6D2 |
| InChI Key |
HJOVHMDZYOCNQW-WOACEMEVSA-N |
| Functional Group |
Ketones & Ketals |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(C(C(C1=O)([2H])[2H])(C)C)([2H])[2H])C([2H])([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
78-59-1 |
| Unlabeled Synonyms |
3,5,5-Trimethyl-2-cyclohexene-1-one |
