| Catalog Number |
ACM1173020217-1 |
| CAS |
1173020-21-7 |
| Structure |
 |
| Description |
3-Indoleacetic acid-d7 is the deuterium labeled 3-Indoleacetic acid. 3-Indoleacetic acid (Indole-3-acetic acid) is the most common natural plant growth hormone of the auxin class. |
| Synonyms |
Indole-3-acetic acid-d7; 3-IAA-d7 |
| Molecular Weight |
182.23 |
| Molecular Formula |
C10H2D7NO2 |
| Canonical SMILES |
OC(C([2H])([2H])C1=C([2H])NC2=C([2H])C([2H])=C([2H])C([2H])=C12)=O |
| Purity |
≥99.00% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
