| Catalog Number |
ACM76937785-1 |
| CAS |
76937-78-5 |
| Structure |
 |
| Description |
3-Indoleacetic acid-d5 is deuterium-labeled 3-indoleacetic acid and can be used as an internal standard for the determination of IAA released by alkaline decomposition of ester and amide conjugates. |
| Synonyms |
Indole-3-acetic acid-d5; 3-IAA-d5 |
| Molecular Weight |
180.21 |
| Molecular Formula |
C10H4D5NO2 |
| Canonical SMILES |
[2H]C1=C([2H])C([2H])=C([2H])C2=C1NC([2H])=C2CC(O)=O |
| Purity |
0.9984 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
