| Catalog Number |
ACM76937785 |
| CAS |
76937-78-5 |
| Structure |
 |
| Synonyms |
3-Indolylacetic Acid; Heteroauxin; 1H-Indole-3-acetic Acid; β-Indoleacetic Acid |
| IUPAC Name |
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid |
| Molecular Weight |
180.22 |
| Molecular Formula |
C10H4D5NO2 |
| Canonical SMILES |
C1=CC=C2C(=C1)C(=CN2)CC(=O)O |
| InChI Key |
SEOVTRFCIGRIMH-SNOLXCFTSA-N |
| Melting Point |
165-169ºC(lit.) |
| Purity |
98 atom % D |
| Exact Mass |
180.09500 |
| Functional Group |
Amines & Amine Salts,Carboxylic Acids & Salts,Heterocycles |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
87-51-4 |
