| Catalog Number |
ACM6923019-1 |
| CAS |
6923-01-9 |
| Structure |
 |
| Synonyms |
1H-Imidazole-1,2,4,5-d4 |
| IUPAC Name |
1,2,4,5-tetradeuterioimidazole |
| Molecular Weight |
72.10 |
| Molecular Formula |
C3D4N2 |
| InChI |
InChI=1S/C3H4N2/c1-2-5-3-4-1/h1-3H,(H,4,5)/i1D,2D,3D/hD |
| InChI Key |
RAXXELZNTBOGNW-MSWVZFBTSA-N |
| Boiling Point |
256 °C (lit.) |
| Melting Point |
89-91 °C (lit.) |
| Flash Point |
145 °C |
| Hazards |
Corrosive |
| Isomeric SMILES |
[2H]C1=C(N(C(=N1)[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
288-32-4 |
| Unlabeled Synonyms |
Glyoxaline; 1,3-Diazole; 1,3-Diaza-2,4-cyclopentadiene |
