| Catalog Number |
ACMA00045914 |
| Description |
Imazamox-13C,d3 is the 13C- and deuterium labeled Imazamox. Imazamox is an imidazolinone herbicide that is an inhibitor of acetolactate synthase (ALS) or acetate hydroxy acid synthase (AHAs). It destroys protein synthesis, interferes with DNA synthesis, cell division and growth, and ultimately causes plant death. |
| Synonyms |
CL29926-13C,d3; (±)-Imazamox-13C,d3 |
| Molecular Weight |
309.34 |
| Molecular Formula |
C1413CH16D3N3O4 |
| Canonical SMILES |
O=C(O)C1=C(C2=NC(C)(C(C)C)C(N2)=O)N=CC(CO[13C]([2H])([2H])[2H])=C1 |
| Purity |
0.9963 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
