Imazalil D5 (2-propenyl D5) 100 µg/mL in Acetone
| Catalog Number |
ACM1398065912-1 |
| CAS |
1398065-91-2 |
| Structure |
 |
| IUPAC Name |
1-[2-(2,4-dichlorophenyl)-2-(1,1,2,3,3-pentadeuterioprop-2-enoxy)ethyl]imidazole |
| Molecular Weight |
302.21 |
| Molecular Formula |
C14D5H9Cl2N2O |
| Canonical SMILES |
[2H]C(=C([2H])C([2H])([2H])OC(Cn1ccnc1)c2ccc(Cl)cc2Cl)[2H] |
| InChI |
InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2/i1D2,2D,7D2 |
| Storage |
+20 °C |
| Accurate Mass |
301.0797 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
