3-Hydroxy Desloratadine-d4
| Catalog Number |
ACM1246819997 |
| CAS |
1246819-99-7 |
| Structure |
 |
| Synonyms |
8-Chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-3-ol-d4, 3-Hydroxydesloratadine-d4, Sch 45581-d4 |
| Molecular Weight |
330.84 |
| Molecular Formula |
C19H15D4ClN2O |
| Canonical SMILES |
ClC1=CC(CCC2=CC(O)=CN=C2/3)=C(C=C1)C3=C4CC([2H])([2H])NC([2H])([2H])C\4 |
| Storage |
-20 °C |
| API Family |
Loratadine |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
119410-08-1 |
Please kindly note that our products and services are for research use only.
