Hexazinone D6 (N,N-dimethyl D6) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM1219804224-2 |
| CAS |
1219804-22-4 |
| Structure |
 |
| Synonyms |
Hexazinone D6 (N,N-dimethyl D6), 6-[Bis(trideuteriomethyl)amino]-3-cyclohexyl-1-methyl-1,3,5-triazine-2,4-dione |
| IUPAC Name |
6-[bis(trideuteriomethyl)amino]-3-cyclohexyl-1-methyl-1,3,5-triazine-2,4-dione |
| Molecular Weight |
258.35 |
| Molecular Formula |
C12D6H14N4O2 |
| Canonical SMILES |
[2H]C([2H])([2H])N(C1=NC(=O)N(C2CCCCC2)C(=O)N1C)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
258.1963 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
