| Catalog Number |
ACM55320699-3 |
| CAS |
55320-69-9 |
| Structure |
 |
| Synonyms |
1-Hexanoic-d3 Acid, 1-Pentane-d3-carboxylic Acid, Butyl-d3-acetic Acid, Caproic-d3 Acid, Capronic-d3 Acid, Hexoic-d3 Acid, Hexylic-d3 Acid, NSC 35598-d3, NSC 8266-d3, Pentylformic-d3 Acid, n-Caproic-d3 Acid, n-Hexanoic-d3 Acid, n-Hexoic-d3 Acid, n-Hexylic-d3 Acid, Hexanoic-6,6,6-d3 acid (9CI), Hexanoic acid-d3, Hexanoic-?-d3 acid, Caproic-?-d3 acid |
| IUPAC Name |
6,6,6-trideuteriohexanoic acid |
| Molecular Weight |
119.18 |
| Molecular Formula |
C6D3H9O2 |
| Canonical SMILES |
[2H]C([2H])([2H])CCCCC(=O)O |
| InChI |
InChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/i1D3 |
| InChI Key |
FUZZWVXGSFPDMH-FIBGUPNXSA-N |
| Boiling Point |
202-203ºC(lit.) |
| Melting Point |
-3ºC(lit.) |
| Flash Point |
220 °F |
| Purity |
99 atom % D |
| Density |
0.951 g/mL at 25ºC |
| Accurate Mass |
119.1026 |
| Exact Mass |
119.10300 |
| Format |
Neat |
| Functional Group |
Carboxylic Acids & Salts |
| Isotopic Enrichment |
99 atom % D |
| Packaging |
0.1 g
In Stock
0.5 g
In Stock |
| Shipping Hazards |
CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
142-62-1 |
