| Catalog Number |
ACM95348440-2 |
| CAS |
95348-44-0 |
| Structure |
 |
| Synonyms |
n-Caproic Acid |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoic acid |
| Molecular Weight |
127.23 |
| Molecular Formula |
C6D11HO2 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI |
InChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/i1D3,2D2,3D2,4D2,5D2 |
| Purity |
98 atom % D |
| Accurate Mass |
127.1528 |
| Format |
Neat |
| Functional Group |
Carboxylic Acids & Salts |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
142-62-1 |
