| Catalog Number |
ACM19031551-1 |
| CAS |
19031-55-1 |
| Structure |
 |
| Synonyms |
Adipic acid-2,2,5,5-D4 |
| IUPAC Name |
2,2,5,5-tetradeuteriohexanedioic acid |
| Molecular Weight |
150.17 |
| Molecular Formula |
C6H6D4O4 |
| InChI |
InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)/i3D2,4D2 |
| InChI Key |
WNLRTRBMVRJNCN-KHORGVISSA-N |
| Boiling Point |
265 °C at 100 mmHg (lit.) |
| Melting Point |
151-154 °C (lit.) |
| Chemical Formula |
HOOCCD2(CH2)2CD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCC([2H])([2H])C(=O)O)C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-04-9 |
| Unlabeled Synonyms |
Adipic acid |
