| Catalog Number |
ACM287100872-1 |
| CAS |
287100-87-2 |
| Structure |
 |
| Synonyms |
(213C)Hexadecanoic acid |
| IUPAC Name |
(2-13C)hexadecanoic acid |
| Molecular Weight |
257.44 |
| Molecular Formula |
13CC15H32O |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i15+1 |
| InChI Key |
IPCSVZSSVZVIGE-XPOOIHDOSA-N |
| Boiling Point |
271.5 °C at 100 mmHg (lit.) |
| Melting Point |
61-64 °C (lit.) |
| Density |
0.855 g/mL at 25 °C |
| Chemical Formula |
CH3(CH2)13*CH2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
CCCCCCCCCCCCCC[13CH2]C(=O)O |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid, Cetylic acid; Hexadecylic acid |
