Catalog Number |
ACM1173022495-1 |
CAS |
1173022-49-5 |
IUPAC Name |
13,13,14,14,15,15,16,16,16-nonadeuteriohexadecanoic acid |
Molecular Weight |
265.48 |
Molecular Formula |
C16H23D9O2 |
InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3,2D2,3D2,4D2 |
InChI Key |
IPCSVZSSVZVIGE-YNSOAAEFSA-N |
Chemical Formula |
CD3(CD2)3(CH2)11COOH |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCCCCCC(=O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
57-10-3 |
Unlabeled Synonyms |
Palmitic acid; Cetylic acid; Hexadecylic acid |