Hexacosanoic-12,12,13,13-d4 acid
| Catalog Number |
ACM1194984854-1 |
| CAS |
1194984-85-4 |
| Structure |
 |
| IUPAC Name |
12,12,13,13-tetradeuteriohexacosanoic acid |
| Molecular Weight |
400.72 |
| Molecular Formula |
C26H48D4O2 |
| InChI |
InChI=1S/C26H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h2-25H2,1H3,(H,27,28)/i14D2,15D2 |
| InChI Key |
XMHIUKTWLZUKEX-QZPARXMSSA-N |
| Chemical Formula |
CH3(CH2)12(CD2)2(CH2)10COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCC)C([2H])([2H])CCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-46-7 |
| Unlabeled Synonyms |
Ceratinic acid; Cerotic acid |
Please kindly note that our products and services are for research use only.
