| Catalog Number |
ACM202528958 |
| CAS |
202528-95-8 |
| Structure |
 |
| Synonyms |
Margaric acid(d3); 17,17,17-Trideuterioheptadecanoic acid |
| IUPAC Name |
17,17,17-trideuterioheptadecanoic acid |
| Molecular Weight |
273.47 |
| Molecular Formula |
C17H31D3O2 |
| InChI |
InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2,1H3,(H,18,19)/i1D3 |
| InChI Key |
KEMQGTRYUADPNZ-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)15COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
506-12-7 |
| Unlabeled Synonyms |
n-Heptadecylic acid, Margaric acid |
