Guanidine-15N3 hydrochloride
| Catalog Number |
ACM121616395-1 |
| CAS |
121616-39-5 |
| Structure |
 |
| Synonyms |
Guanidine-15N3 Monohydrochloride |
| Molecular Weight |
98.51 |
| Molecular Formula |
CH6Cl15N3 |
| Canonical SMILES |
Cl.[15NH2]C([15NH2])=[15NH] |
| InChI |
1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H/i2+1,3+1,4+1; |
| InChI Key |
PJJJBBJSCAKJQF-ZNYUTZBJSA-N |
| Melting Point |
185-189 °C (lit.) |
| Appearance |
solid |
| Storage |
Store at room temperature away from light and moisture. |
| Exact Mass |
98.0161 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
1.1409 |
| Mass Shift |
M+3 |
| MDL Number |
MFCD01075616 |
| PSA |
75.89 |
| Quality Level |
200 |
| Type |
Research Compounds |
Please kindly note that our products and services are for research use only.
