Glyphosate 1,2-13C2 15N 100 µg/mL in Water
| Catalog Number |
ACM1185107634-1 |
| CAS |
1185107-63-4 |
| Structure |
 |
| Synonyms |
Glyphosate 1,2-13C2 15N |
| IUPAC Name |
2-(phosphonomethylamino)acetic acid |
| Molecular Weight |
172.05 |
| Molecular Formula |
13C2CH815NO5P |
| Canonical SMILES |
O[13C](=O)[13CH2][15NH]CP(=O)(O)O |
| InChI |
InChI=1S/C3H8NO5P/c5-3(6)1-4-2-10(7,8)9/h4H,1-2H2,(H,5,6)(H2,7,8,9)/i1+1,3+1,4+1 |
| Storage |
+20 °C |
| Accurate Mass |
172.0178 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Nitrogen, Carbon |
| Unlabeled CAS |
1071-83-6 |
Please kindly note that our products and services are for research use only.
