| Catalog Number |
ACM4896779 |
| CAS |
4896-77-9 |
| Structure |
 |
| Synonyms |
(2H5)Glycine |
| IUPAC Name |
deuterio 2,2-dideuterio-2-(dideuterioamino)acetate |
| Molecular Weight |
80.10 |
| Molecular Formula |
C2D5NO2 |
| Canonical SMILES |
[2H]C([2H])(C(=O)O[2H])N([2H])[2H] |
| InChI |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2/hD3 |
| InChI Key |
DHMQDGOQFOQNFH-LGLHGEJLSA-N |
| Boiling Point |
240.9ºC at 760 mmHg |
| Melting Point |
240 °C (dec.) (lit.) |
| Flash Point |
99.5ºC |
| Purity |
98 atom % D |
| Density |
1.254 g/cm³ |
| Appearance |
White powder |
| Chemical Formula |
D2NCD2COOD |
| EC Number |
225-518-6 |
| Exact Mass |
80.06340 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O[2H])N([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-40-6 |
| Unlabeled Synonyms |
Aminoacetic acid; H-Gly-OH |
