Catalog Number |
ACM4896779 |
CAS |
4896-77-9 |
Structure |
 |
Synonyms |
(2H5)Glycine |
IUPAC Name |
deuterio 2,2-dideuterio-2-(dideuterioamino)acetate |
Molecular Weight |
80.10 |
Molecular Formula |
C2D5NO2 |
Canonical SMILES |
[2H]C([2H])(C(=O)O[2H])N([2H])[2H] |
InChI |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2/hD3 |
InChI Key |
DHMQDGOQFOQNFH-LGLHGEJLSA-N |
Boiling Point |
240.9ºC at 760 mmHg |
Melting Point |
240 °C (dec.) (lit.) |
Flash Point |
99.5ºC |
Purity |
98 atom % D |
Density |
1.254 g/cm³ |
Appearance |
White powder |
Chemical Formula |
D2NCD2COOD |
EC Number |
225-518-6 |
Exact Mass |
80.06340 |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])(C(=O)O[2H])N([2H])[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
56-40-6 |
Synonyms (Unlabeled) |
Aminoacetic acid; H-Gly-OH |