| Catalog Number |
ACM4896757 |
| CAS |
4896-75-7 |
| Structure |
 |
| Synonyms |
Glycine-[2,2-D2] |
| IUPAC Name |
2-amino-2,2-dideuterioacetic acid |
| Molecular Weight |
77.08 |
| Molecular Formula |
C2H3D2NO2 |
| Canonical SMILES |
[2H]C([2H])(C(=O)O)N |
| InChI |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2 |
| InChI Key |
DHMQDGOQFOQNFH-DICFDUPASA-N |
| Melting Point |
240 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
H2NCD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O)N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-40-6 |
| Unlabeled Synonyms |
Aminoacetic acid; H-Gly-OH |
