Catalog Number |
ACM241157062 |
CAS |
241157-06-2 |
Structure |
 |
Synonyms |
Glyceryl trihexadecanoate-d2; Hexadecanoic-2,2-d2 acid 1,2,3-propanetriyl ester |
IUPAC Name |
2,3-bis(2,2-dideuteriohexadecanoyloxy)propyl 2,2-dideuteriohexadecanoate |
Molecular Weight |
813.37 |
Molecular Formula |
C51H92D6O6 |
InChI |
InChI=1S/C51H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-47H2,1-3H3/i43D2,44D2,45D2 |
InChI Key |
PVNIQBQSYATKKL-LYUMNRDXSA-N |
Purity |
98 atom % D |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCCC)C(=O)OCC(COC(=O)C([2H])([2H])CCCCCCCCCCCCCC)OC(=O)C([2H])([2H])CCCCCCCCCCCCCC |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
555-44-2 |
Synonyms (Unlabeled) |
Glyceryl tripalmitate; Tripalmitin |