Catalog Number |
ACM565183246-1 |
CAS |
565183-24-6 |
Structure |
|
Synonyms |
Rac 1-Oleoyl glycerol-D5 |
IUPAC Name |
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (Z)-octadec-9-enoate |
Molecular Weight |
361.60 |
Molecular Formula |
C21H35D5O4 |
InChI |
InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/i18D2,19D2,20D |
InChI Key |
RZRNAYUHWVFMIP-FNKKQMTJSA-N |
Appearance |
Off-white waxy solid |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])(C([2H])(C([2H])([2H])OC(=O)CCCCCCC/C=C\CCCCCCCC)O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store refrigerated |
Unlabeled CAS |
111-03-5 |
Unlabeled Synonyms |
(±)-Glyceryl 1-(cis-9-octadecenoate); (±)-1-Monoolein; 1-Oleyl-rac-glycerol |