| Catalog Number |
ACM7325179 |
| CAS |
7325-17-9 |
| Structure |
 |
| Synonyms |
1,2,3-Propanetriol-d8; Deuterated glycerol |
| IUPAC Name |
1,1,2,3,3-pentadeuterio-1,2,3-trideuteriooxypropane |
| Molecular Weight |
100.14 |
| Molecular Formula |
C3D8O3 |
| InChI |
InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D2,2D2,3D,4D,5D,6D |
| InChI Key |
PEDCQBHIVMGVHV-YHPVEMKJSA-N |
| Boiling Point |
182 °C (lit.) |
| Melting Point |
20 °C (lit.) |
| Flash Point |
>230 °F (lit.) |
| Density |
1.371 g/mL at 25 °C |
| Appearance |
Colourless viscous liquid |
| Chemical Formula |
(DOCD2)2CDOD |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C([2H])(C([2H])([2H])O[2H])O[2H])O[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-81-5 |
| Unlabeled Synonyms |
Glycerin; 1,2,3-Propanetriol |
