| Catalog Number |
ACM1542211404 |
| CAS |
1542211-40-4 |
| Synonyms |
[2H6]-Gestodene |
| IUPAC Name |
(8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10-hexadeuterio-13-ethyl-17-ethynyl-17-hydroxy-7,8,9,11,12,14-hexahydro-1H-cyclopenta[a]phenanthren-3-one |
| Molecular Weight |
316.47 |
| Molecular Formula |
C21H20D6O2 |
| InChI |
InChI=1S/C21H26O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,10,12-13,16-19,23H,3,5-9,11H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1/i5D2,6D2,13D,16D |
| InChI Key |
SIGSPDASOTUPFS-PWFLSJGKSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3CC2([2H])[2H])C=C[C@]4(C#C)O)CC)[2H] |
| Isotopic Enrichment |
96 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
60282-87-3 |
| Unlabeled Synonyms |
17α-Ethynyl-17β-hydroxy-18-methyl-4,15-estradien-3-one |
