Furan D4 100 µg/mL in Acetonitrile
| Catalog Number |
ACM6142901-2 |
| CAS |
6142-90-1 |
| Structure |
 |
| Synonyms |
Furan-2,3,4,5-d4, Furan-d4 (7CI,8CI,9CI), Perdeuteriofuran, Tetradeuteriofuran |
| IUPAC Name |
2,3,4,5-tetradeuteriofuran |
| Molecular Weight |
72.1 |
| Molecular Formula |
C4D4O |
| Canonical SMILES |
[2H]c1oc([2H])c([2H])c1[2H] |
| InChI |
InChI=1S/C4H4O/c1-2-4-5-3-1/h1-4H/i1D,2D,3D,4D |
| Storage |
+20 °C |
| Accurate Mass |
72.0513 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
110-00-9 |
Please kindly note that our products and services are for research use only.
