| Catalog Number |
ACM24461323-1 |
| CAS |
24461-32-3 |
| Structure |
 |
| Synonyms |
Fumaric acid-[2,3-D2] |
| IUPAC Name |
(E)-2,3-dideuteriobut-2-enedioic acid |
| Molecular Weight |
118.09 |
| Molecular Formula |
C4H2D2O4 |
| InChI |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i1D,2D |
| InChI Key |
VZCYOOQTPOCHFL-FBBQFRKLSA-N |
| Melting Point |
299-300 °C (subl.) (lit.) |
| Flash Point |
230 °C |
| Chemical Formula |
HOOCCD=CDCOOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]/C(=C(/[2H])\C(=O)O)/C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
110-17-8 |
| Unlabeled Synonyms |
trans-Butenedioic acid |
