| Catalog Number |
ACM200937571-2 |
| CAS |
200937-57-1 |
| Structure |
 |
| Description |
L-Leucine N-Fmoc (15N, 98%) is a protected amino acid used to synthesize isotope-labeled peptides for MS-based protein quantitation. |
| Synonyms |
N-(9-Fluorenylmethoxycarbonyl)-L-leucine, Fmoc-L-leucine; N-(9-Fluorenylmethoxycarbonyl)-L-leucine-15N, L-Leucine-15N, N-Fmoc, 15N Labeled Fmoc Leucine, 15N Labeled Fmoc-Leu-OH |
| Molecular Weight |
354.41 |
| Molecular Formula |
(CH3)2CHCH2CH(15NH-FMOC)COOH |
| Canonical SMILES |
CC(C)C[C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| InChI |
1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1/i22+1 |
| InChI Key |
CBPJQFCAFFNICX-VIKCBUFNSA-N |
| Melting Point |
152-156 °C (lit.) |
| Purity |
98% (CP) |
| Appearance |
solid |
| Application |
Biomolecular NMR, Proteomics |
| Storage |
Store refrigerated (-5 °C - 5 °C) and dessicated. |
| EC Number |
252-662-7 (Unlabeled) |
| Exact Mass |
354.16 |
| Isotopic Enrichment |
98 atom % 15N |
| LogP |
4.4153 |
| Mass Shift |
M+1 |
| MDL Number |
MFCD00209748 |
| Optical Activity |
[α]20/D -25°, c = 0.5 in DMF |
| PSA |
75.63 |
| Type |
Labeled Amino Acids and Derivatives |
| Unlabeled CAS |
35661-60-0 |
| WGK Germany |
3 |
